
Catalog Number	AR003MUV
Chemical Name	5-(4-Fluorophenyl)cyclohexane-1,3-dione
CAS Number	55579-72-1
Molecular Formula	C12H11FO2
Molecular Weight	206.2129
MDL Number	MFCD00174037
SMILES	O=C1CC(CC(=O)C1)c1ccc(cc1)F

The compound 5-(4-Fluorophenyl)-1,3-cyclohexanedione plays a crucial role in chemical synthesis as a versatile building block for creating various organic compounds. It serves as a key intermediate in the preparation of diverse pharmaceuticals, agrochemicals, and fine chemicals. Its unique structure makes it a valuable substrate for the synthesis of complex molecules with biological activity. Additionally, 5-(4-Fluorophenyl)-1,3-cyclohexanedione is employed in the development of innovative materials and catalysts due to its reactivity and structural properties. Its application in organic synthesis extends to the production of specialty chemicals and natural product derivatives, making it a valuable tool for chemists working in medicinal chemistry, material science, and related research fields.

5-(4-Fluorophenyl)cyclohexane-1,3-dione

55579-72-1

Product Details