
Catalog Number	AR0034KT
Chemical Name	1-(4-Chloro-3-nitrophenyl)ethanone
CAS Number	5465-65-6
Molecular Formula	C8H6ClNO3
Molecular Weight	199.5911
MDL Number	MFCD00007083
SMILES	[O-][N+](=O)c1cc(ccc1Cl)C(=O)C
NSC Number	25820

1-(4-Chloro-3-nitrophenyl)ethanone is a versatile compound that finds key applications in chemical synthesis. Its unique structure, characterized by the presence of a chloro-nitrophenyl group attached to an ethanone backbone, imparts valuable properties that are highly sought after in various synthetic processes. In organic chemistry, this compound serves as a valuable building block for the synthesis of diverse compounds due to its reactivity and ability to participate in a wide range of chemical reactions. Specifically, 1-(4-Chloro-3-nitrophenyl)ethanone can be used as a precursor in the preparation of pharmaceuticals, agrochemicals, and specialty chemicals. Its chloro-nitrophenyl moiety can be selectively modified to introduce specific functional groups or structural motifs, allowing for the efficient synthesis of complex molecules with tailored properties. Moreover, this compound can act as a key intermediate in the production of dyes, polymers, and other fine chemicals, where its unique structural features contribute to the desired reactivity and performance of the final products. Overall, the application of 1-(4-Chloro-3-nitrophenyl)ethanone in chemical synthesis enables the efficient and controlled construction of diverse organic compounds with wide-ranging industrial and scientific significance.

1-(4-Chloro-3-nitrophenyl)ethanone

5465-65-6

Product Details