
Catalog Number	AR0037SF
Chemical Name	5-Chloro-3-nitropyridin-2-amine
CAS Number	5409-39-2
Molecular Formula	C5H4ClN3O2
Molecular Weight	173.5572
MDL Number	MFCD00092011
SMILES	Clc1cnc(c(c1)[N+](=O)[O-])N
NSC Number	12459

5-Chloro-3-nitropyridin-2-amine, also known as $name$, is a valuable compound that finds widespread application in the field of chemical synthesis. This compound plays a crucial role in the preparation of various pharmaceutical agents and functional materials.One of the primary uses of 5-Chloro-3-nitropyridin-2-amine in chemical synthesis is its involvement in the synthesis of heterocyclic compounds. By serving as a key building block, this compound participates in the construction of complex molecular structures through versatile reactions such as nucleophilic substitution, reduction, and coupling reactions.Furthermore, 5-Chloro-3-nitropyridin-2-amine is utilized in the development of agrochemicals and crop protection agents. Its unique structure and reactivity enable the synthesis of compounds with potent biological activities, making it an essential component in the design and production of effective pesticides and herbicides.Additionally, this compound is employed in the synthesis of various dyes and pigments. Its ability to undergo selective chemical transformations allows for the creation of colorful and high-performance dyes used in textiles, plastics, and other materials.Overall, the versatility and reactivity of 5-Chloro-3-nitropyridin-2-amine make it a valuable tool in chemical synthesis, enabling the efficient production of a wide range of compounds with diverse applications in pharmaceuticals, agrochemicals, and materials science.