
Catalog Number	AR00D9H9
Chemical Name	METHYL 1-(DIPHENYLMETHYL)AZETIDINE-3-CARBOXYLATE
CAS Number	53871-06-0
Molecular Formula	C18H19NO2
Molecular Weight	281.349
MDL Number	MFCD03407521
SMILES	COC(=O)C1CN(C1)C(c1ccccc1)c1ccccc1

Methyl 1-benzhydrylazetidine-3-carboxylate, a versatile building block in chemical synthesis, plays a crucial role in the formation of complex organic molecules. With its unique structure and reactivity, this compound serves as an essential intermediate for the synthesis of diverse pharmaceuticals, agrochemicals, and materials. In chemical synthesis, Methyl 1-benzhydrylazetidine-3-carboxylate facilitates the construction of intricate molecular frameworks through strategic transformations such as ring-opening reactions, functional group modifications, and bond formations. By serving as a key starting material, it enables chemists to access a wide range of structurally diverse compounds with precise control over stereochemistry and regiochemistry.This compound's utility extends to the preparation of bioactive molecules, natural product analogs, and advanced materials with tailored properties. Its incorporation in synthetic pathways allows for the efficient assembly of complex molecular structures with high synthetic efficiency and selectivity. Overall, Methyl 1-benzhydrylazetidine-3-carboxylate is an indispensable tool for chemists engaged in the design and synthesis of novel compounds with diverse applications in various industries.