
Catalog Number	AR003B36
Chemical Name	1,4-diaminoanthracene-9,10-diol
CAS Number	5327-72-0
Molecular Formula	C14H12N2O2
Molecular Weight	240.2573
MDL Number	MFCD00126953
SMILES	Nc1ccc(c2c1c(O)c1ccccc1c2O)N
NSC Number	3393

1,4-diaminoanthracene-9,10-diol, often referred to as $name$, is a versatile chemical compound widely utilized in chemical synthesis processes. This organic molecule plays a crucial role in various reactions due to its unique structure and reactivity.In chemical synthesis, $name$ serves as an essential building block for the creation of complex organic compounds. Its primary application lies in the formation of heterocyclic compounds, particularly in the synthesis of functionalized anthraquinones and related derivatives. By incorporating $name$ into reaction schemes, chemists can introduce specific functional groups and stereochemistry, ultimately leading to the development of new materials with tailored properties.Furthermore, 1,4-diaminoanthracene-9,10-diol exhibits excellent stability under a wide range of reaction conditions, making it a preferred reagent in synthetic methodologies. Its ability to undergo various transformations, such as aromatic substitution and oxidative coupling reactions, allows for the efficient construction of intricate molecular structures.Overall, the significance of 1,4-diaminoanthracene-9,10-diol in chemical synthesis lies in its versatility and applicability in generating diverse organic compounds with enhanced properties and functionalities.