
Catalog Number	AR00DD1Q
Chemical Name	1-Isopropylamino-3-(naphthalen-1-yloxy)-propan-2-ol
CAS Number	525-66-6
Molecular Formula	C16H21NO2
Molecular Weight	259.34344000000004
MDL Number	MFCD00062560
SMILES	OC(COc1cccc2c1cccc2)CNC(C)C

1-(1-Naphthyloxy)-3-(isopropylamino)-2-propanol is a versatile compound frequently used in chemical synthesis. It serves as a key building block in the production of various pharmaceuticals and fine chemicals due to its unique structure and reactivity. This compound plays a crucial role in the development of new drugs, agrochemicals, and materials by functioning as a chiral intermediate or a precursor to complex molecules. Its functional groups provide opportunities for selective transformations, enabling chemists to tailor its properties for specific applications. Overall, 1-(1-Naphthyloxy)-3-(isopropylamino)-2-propanol is a valuable tool in the synthesis of diverse compounds with potential medical, agricultural, and industrial uses.