
Catalog Number	AR003BRB
Chemical Name	3-METHYL-2-(4-CHLOROPHENYL)BUTYRYL CHLORIDE
CAS Number	51631-50-6
Molecular Formula	C11H12Cl2O
Molecular Weight	231.1184
MDL Number	MFCD03093952
SMILES	CC(C(c1ccc(cc1)Cl)C(=O)Cl)C

2-(4-Chlorophenyl)-3-methylbutanoyl chloride, also known as $name$, is a versatile chemical compound widely used in various chemical synthesis applications. This compound serves as an important acyl chloride, playing a key role in the production of a wide range of organic compounds. When $name$ is utilized in chemical reactions, it can undergo acylation reactions with nucleophiles, leading to the formation of new chemical entities with diverse properties.In organic synthesis, 2-(4-Chlorophenyl)-3-methylbutanoyl chloride is commonly employed as a reactive intermediate in the preparation of pharmaceuticals, agrochemicals, and specialty chemicals. Its acyl chloride functionality enables it to participate in processes such as Friedel-Crafts acylation, peptide synthesis, and other acylation reactions that are fundamental in the construction of more complex molecules.Furthermore, the precise and controlled reactivity of $name$ makes it a valuable tool in the design and production of advanced materials, fine chemicals, and bioactive compounds. By incorporating this compound into synthetic routes, chemists can access a wide array of functionalized molecules with tailored properties for various applications in the fields of medicine, materials science, and chemical engineering.