
Catalog Number	AR006XYZ
Chemical Name	4-Bromo-N,N-dimethyl-3-(trifluoromethyl)aniline
CAS Number	51332-24-2
Molecular Formula	C9H9BrF3N
Molecular Weight	268.0737
MDL Number	MFCD00219439
SMILES	CN(c1ccc(c(c1)C(F)(F)F)Br)C

4-Bromo-N,N-dimethyl-3-(trifluoromethyl)aniline is a versatile compound that finds crucial applications in chemical synthesis. This compound is particularly valued for its role as a reactive intermediate in organic chemistry. Due to the presence of the bromine, dimethyl, and trifluoromethyl functional groups, this compound can participate in various synthetic reactions, making it a valuable building block for creating complex organic molecules. Its unique structure enables it to act as a versatile precursor in the synthesis of pharmaceuticals, agrochemicals, and materials with specialized properties. Additionally, 4-Bromo-N,N-dimethyl-3-(trifluoromethyl)aniline can be utilized in metal-catalyzed cross-coupling reactions, C-H activation processes, and other transformations to introduce specific functional groups into target molecules. Its diverse reactivity and compatibility with various synthetic methodologies make it a valuable tool for chemists involved in the design and preparation of new compounds with tailored properties.