
Catalog Number	AR003M6K
Chemical Name	2'-Nitro-[1,1'-biphenyl]-4-ol
CAS Number	51264-59-6
Molecular Formula	C12H9NO3
Molecular Weight	215.2048
MDL Number	MFCD13151975
SMILES	Oc1ccc(cc1)c1ccccc1[N+](=O)[O-]

2-Nitro-[1,1'-biphenyl]-4-ol, commonly referred to as $name$, is a versatile compound extensively utilized in chemical synthesis procedures. As a key reagent in organic chemistry, this compound serves as a crucial building block for the creation of various pharmaceuticals, agrochemicals, and specialty chemicals. Its unique chemical structure allows for selective modifications, enabling chemists to fine-tune reactions and achieve desired outcomes with precision. In the realm of medicinal chemistry, 2-Nitro-[1,1'-biphenyl]-4-ol plays a pivotal role in synthesizing potential drug candidates by facilitating the introduction of specific functional groups that enhance biological activity. Furthermore, in material science, this compound is instrumental in the synthesis of specialized polymers and dyes, contributing to the development of innovative materials with tailored properties. Overall, the application of 2-Nitro-[1,1'-biphenyl]-4-ol in chemical synthesis underscores its significance as a fundamental component in the advancement of diverse scientific fields.

2'-Nitro-[1,1'-biphenyl]-4-ol

51264-59-6

Product Details