
Catalog Number	AR003O29
Chemical Name	7-Benzoylindolin-2-one
CAS Number	51135-38-7
Molecular Formula	C15H11NO2
Molecular Weight	237.2533
MDL Number	MFCD07784039
SMILES	O=C1Cc2c(N1)c(ccc2)C(=O)c1ccccc1

7-Benzoylindolin-2-one, a versatile compound in chemical synthesis, serves as a key building block in the creation of diverse organic molecules. Its unique structure and reactivity make it a valuable tool for the construction of complex molecular structures. In the realm of drug discovery, this compound plays a crucial role as a precursor to various pharmaceutical agents by participating in important reactions such as Friedel-Crafts acylation and nucleophilic addition. Furthermore, its presence in natural product synthesis highlights its significance in accessing biologically active compounds. With its ability to undergo diverse transformations, 7-Benzoylindolin-2-one is an indispensable component in the hands of synthetic chemists striving to develop novel materials and therapeutic agents.

7-Benzoylindolin-2-one

51135-38-7

Product Details