
Catalog Number	AR01DE5C
Chemical Name	Mitraphylline
CAS Number	509-80-8
Molecular Formula	C21H24N2O4
Molecular Weight	368.4263
MDL Number	MFCD01861514
SMILES	COC(=O)C1=CO[C@H]([C@@H]2[C@@H]1C[C@@H]1N(C2)CC[C@@]21C(=O)Nc1c2cccc1)C
NSC Number	717700

Mitraphylline, a natural alkaloid found in plants belonging to the Mitragyna genus, has gained significant interest in chemical synthesis due to its unique properties and versatile applications. In the realm of organic chemistry, Mitraphylline serves as a valuable building block for the synthesis of various complex molecules and pharmaceutical compounds. Its structural features make it a promising precursor in the development of novel drugs and bioactive substances. With its diverse reactivity and compatibility with numerous synthetic methods, Mitraphylline offers researchers a wide array of opportunities for creating new chemical entities with potential therapeutic benefits. Additionally, its bioavailability and pharmacokinetic properties further enhance its appeal as a valuable resource in the field of chemical synthesis.