
Catalog Number	AR003Q6I
Chemical Name	trans-Diethyl cyclohex-4-ene-1,2-dicarboxylate
CAS Number	5048-50-0
Molecular Formula	C12H18O4
Molecular Weight	226.2689
MDL Number	MFCD06799457
SMILES	CCOC(=O)[C@@H]1CC=CC[C@H]1C(=O)OCC

Trans-Diethyl cyclohex-4-ene-1,2-dicarboxylate is a valuable compound in chemical synthesis due to its unique structure and reactivity. This molecule is commonly used as a versatile building block in organic chemistry, particularly in the synthesis of complex pharmaceuticals, agrochemicals, and fine chemicals. Its cyclic structure containing diethyl ester groups makes it a useful precursor for the preparation of various functionalized cyclohexene derivatives.In chemical synthesis, trans-Diethyl cyclohex-4-ene-1,2-dicarboxylate serves as a key intermediate in the formation of substituted cyclohexenes through a variety of chemical transformations such as hydrogenation, hydrolysis, and reduction reactions. Its ability to undergo selective functional group manipulations allows for the introduction of diverse substituents onto the cyclohexene ring, enabling the synthesis of structurally diverse and biologically active compounds.Furthermore, the presence of ester groups in trans-Diethyl cyclohex-4-ene-1,2-dicarboxylate offers opportunities for further derivatization through esterification, transesterification, or cleavage reactions, leading to the generation of novel derivatives with tailored properties. Overall, trans-Diethyl cyclohex-4-ene-1,2-dicarboxylate plays a crucial role in the synthesis of complex molecules with potential applications in medicinal chemistry, material science, and other areas of chemical research.