
Catalog Number	AR006VDU
Chemical Name	2,6-Dichloro-4-(trifluoromethyl)nicotinic acid
CAS Number	503437-19-2
Molecular Formula	C7H2Cl2F3NO2
Molecular Weight	259.9975
MDL Number	MFCD06208180
SMILES	Clc1nc(Cl)c(c(c1)C(F)(F)F)C(=O)O

2,6-Dichloro-4-(trifluoromethyl)nicotinic acid, also known as $name$, is a versatile chemical compound that finds extensive application in chemical synthesis. This compound serves as a crucial building block in the production of various pharmaceuticals, agrochemicals, and advanced materials. Its unique molecular structure lends itself well to a range of synthetic reactions, making it a valuable tool for chemists and researchers.In chemical synthesis, 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid is commonly used as a precursor in the creation of biologically active compounds. Its presence in a molecule can enhance its biological activity or modify its properties, making it indispensable in the pharmaceutical industry. Additionally, this compound is utilized in the development of herbicides, insecticides, and fungicides due to its potent and selective properties.Furthermore, 2,6-Dichloro-4-(trifluoromethyl)nicotinic acid plays a significant role in the synthesis of specialized materials such as liquid crystals, polymers, and dyes. Its ability to participate in various chemical reactions enables the creation of complex structures with tailored functionalities and properties. This compound's versatility and reactivity make it a sought-after component in the realm of material science and organic chemistry.