
Catalog Number	AR003DC0
Chemical Name	(S)-3-((tert-Butoxycarbonyl)amino)-3-(2-(trifluoromethyl)phenyl)propanoic acid
CAS Number	500770-77-4
Molecular Formula	C15H18F3NO4
Molecular Weight	333.3029
MDL Number	MFCD03427925
SMILES	OC(=O)C[C@@H](c1ccccc1C(F)(F)F)NC(=O)OC(C)(C)C

The (S)-3-((tert-Butoxycarbonyl)amino)-3-(2-(trifluoromethyl)phenyl)propanoic acid, also known as $name$, serves as a crucial component in chemical synthesis, particularly in advanced organic chemistry. This compound plays a pivotal role as a chiral building block, enabling the controlled formation of complex molecules with distinct stereochemistry.One notable application of $name$ in chemical synthesis is its utilization as a key intermediate in the preparation of pharmaceutical compounds and agrochemicals. By incorporating this compound into the synthetic route, chemists can introduce chirality at specific positions within the target molecule, ensuring the desired biological activity and enhancing overall efficacy.Moreover, (S)-3-((tert-Butoxycarbonyl)amino)-3-(2-(trifluoromethyl)phenyl)propanoic acid facilitates the creation of structurally diverse compounds with enhanced properties, making it a valuable tool in the development of new materials and functional molecules. Its versatility and compatibility in various reactions make it a sought-after reagent for chemists seeking to design and synthesize novel compounds with tailored properties.In summary, the profound significance of $name$ in chemical synthesis lies in its ability to serve as a versatile and efficient building block for the construction of complex molecules with defined stereochemistry, ultimately driving innovation and advancement in the field of organic chemistry.