
Catalog Number	AR003RW4
Chemical Name	Lactobionic Acid Calcium Salt
CAS Number	5001-51-4
Molecular Formula	C24H42CaO24
Molecular Weight	754.6539
MDL Number	MFCD00135895
SMILES	OC[C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O[C@@H]1O[C@H](CO)[C@@H]([C@@H]([C@H]1O)O)O)O.OC[C@H]([C@H]([C@@H]([C@H](C(=O)[O-])O)O)O[C@@H]1O[C@H](CO)[C@@H]([C@@H]([C@H]1O)O)O)O.[Ca+2]

Calcium lactobionate is a sugar derivative that finds extensive application in chemical synthesis as a chelating agent and stabilizer. In organic chemistry, it is commonly used for its ability to form complexes with metal ions, which is crucial for various synthetic pathways. This compound is particularly valued for its chelating properties with calcium ions, leading to improved stability and solubility in aqueous solutions. Additionally, calcium lactobionate serves as a buffering agent, contributing to the control of pH levels during chemical reactions. Its use in chemical synthesis ensures enhanced efficiency and reproducibility in the production of pharmaceuticals, food additives, and other important chemical compounds.