
Catalog Number	AR0037UT
Chemical Name	(S)-3-((tert-Butoxycarbonyl)amino)-3-(2,4-dichlorophenyl)propanoic acid
CAS Number	499995-81-2
Molecular Formula	C14H17Cl2NO4
Molecular Weight	334.1951
MDL Number	MFCD03427904
SMILES	OC(=O)C[C@@H](c1ccc(cc1Cl)Cl)NC(=O)OC(C)(C)C

The (S)-3-((tert-Butoxycarbonyl)amino)-3-(2,4-dichlorophenyl)propanoic acid plays a crucial role in chemical synthesis due to its versatility and specific reactivity. This compound is commonly utilized as a chiral building block in the creation of pharmaceuticals, agrochemicals, and specialty chemicals.In chemical synthesis, (S)-3-((tert-Butoxycarbonyl)amino)-3-(2,4-dichlorophenyl)propanoic acid serves as a key intermediate in the preparation of various optically pure compounds. Its chiral nature enables the synthesis of enantiomerically pure products, making it highly valuable in asymmetric synthesis. This compound exhibits excellent compatibility with a wide range of reactions, allowing for efficient transformations into complex molecules.Moreover, the presence of the tert-butoxycarbonyl (Boc) protecting group provides stability to reactive functionalities during synthesis, enabling selective manipulations and ensuring controlled reactions. The 2,4-dichlorophenyl moiety further imparts specific chemical properties to the molecule, influencing its interactions with other reagents and reaction conditions.Overall, the (S)-3-((tert-Butoxycarbonyl)amino)-3-(2,4-dichlorophenyl)propanoic acid is a valuable tool in the hands of synthetic chemists, facilitating the construction of intricate molecular structures and enabling the efficient production of highly pure and functionalized compounds.