
Catalog Number	AR006YSW
Chemical Name	BENZENESULFONAMIDE, 4-(1-AMINOETHYL)-
CAS Number	49783-81-5
Molecular Formula	C8H12N2O2S
Molecular Weight	200.2581
MDL Number	MFCD06357420
SMILES	CC(c1ccc(cc1)S(=O)(=O)N)N

4-(1-Aminoethyl)benzenesulfonamide is a versatile compound commonly used in chemical synthesis for the preparation of various pharmaceuticals and organic molecules. This compound serves as a crucial building block in the development of potential drugs and fine chemicals due to its unique properties and structural characteristics.In chemical synthesis, 4-(1-Aminoethyl)benzenesulfonamide is often employed as a key intermediate to introduce the sulfonamide functional group into target molecules. This functional group can impart desirable biological activities and pharmacological properties to the final products, making it valuable in the design and development of therapeutic agents.Moreover, the presence of the aminoethyl group in 4-(1-Aminoethyl)benzenesulfonamide offers opportunities for further derivatization through various chemical reactions. By strategically modifying this compound, chemists can access a wide range of structurally diverse compounds with potential applications in drug discovery, medicinal chemistry, and materials science.Overall, 4-(1-Aminoethyl)benzenesulfonamide plays a crucial role in chemical synthesis by enabling the construction of complex molecules with tailored properties and functionalities. Its versatility and utility make it a valuable tool for researchers and chemists working in diverse fields of chemistry and pharmaceutical science.