
Catalog Number	AR0039SR
Chemical Name	D-Fructose 1,6-Bis(Dihydrogen Phosphate)
CAS Number	488-69-7
Molecular Formula	C6H14O12P2
Molecular Weight	340.1157
MDL Number	MFCD06794967
SMILES	O[C@@H]1[C@@H](COP(=O)(O)O)OC([C@H]1O)(O)COP(=O)(O)O

D-Fructose 1,6-Bis(Dihydrogen Phosphate) is a crucial compound utilized in chemical synthesis as a key intermediate in the glycolysis pathway. This molecule plays a pivotal role in energy production within living organisms, facilitating the breakdown of glucose to generate ATP, the main energy currency of cells. Additionally, D-Fructose 1,6-Bis(Dihydrogen Phosphate) serves as a vital substrate in various enzymatic reactions, specifically in phosphorylation processes that regulate metabolic pathways. Its ability to undergo phosphorylation and subsequent dephosphorylation reactions makes it an essential component in the metabolic machinery of cells, enabling the regulation of energy production and utilization. In chemical synthesis, this compound is commonly employed as a precursor for the production of various phosphorylated compounds, including nucleotides, nucleic acids, and certain biomolecules. Its versatile nature and significance in cellular metabolism make it an indispensable tool in the realm of chemical synthesis, contributing to a wide array of applications in biotechnology, pharmaceuticals, and biochemical research.

D-Fructose 1,6-Bis(Dihydrogen Phosphate)

488-69-7

Product Details