
Catalog Number	AR006XO2
Chemical Name	4-(Benzyloxy);-2-methylene-4-oxobutanoic acid
CAS Number	48162-88-5
Molecular Formula	C12H12O4
Molecular Weight	220.2213
MDL Number	MFCD11553080
SMILES	O=C(CC(=C)C(=O)O)OCc1ccccc1

4-(Benzyloxy)-2-methylene-4-oxobutanoic acid is a valuable intermediate compound widely used in chemical synthesis. This compound plays a crucial role in organic chemistry as a building block for the preparation of various complex molecules. In organic synthesis, 4-(Benzyloxy)-2-methylene-4-oxobutanoic acid is commonly utilized as a key starting material for the construction of diverse pharmaceuticals, agrochemicals, and fine chemicals. Its unique structure and reactivity make it a versatile substrate in the formation of carbon-carbon and carbon-heteroatom bonds through a variety of chemical transformations, including esterification, alkylation, and cyclization reactions. The presence of a benzyl ether group and a methylene group in the molecule provides opportunities for selective functionalization and stereochemical control, leading to the efficient and selective synthesis of target compounds with desired properties and activities. This compound's significance in chemical synthesis lies in its ability to enable the creation of structurally complex and biologically relevant molecules through strategic and diverse synthetic routes.