
Catalog Number	AR003J0E
Chemical Name	3-((1,3-DIHYDROXY-2-(HYDROXYMETHYL)PROPAN-2-YL)AMINO)PROPANE-1-SULFONIC ACID
CAS Number	29915-38-6
Molecular Formula	C7H17NO6S
Molecular Weight	243.278
MDL Number	MFCD00007538
SMILES	OCC(NCCCS(=O)(=O)O)(CO)CO
NSC Number	610928

Tris(hydroxymethyl)methylaminopropanesulfonic acid is a versatile compound frequently utilized in chemical synthesis as a highly effective buffering agent. Its unique structure and properties make it an ideal choice for a wide range of applications in the laboratory setting. This compound is commonly employed in biochemical and molecular biology experiments to maintain stable pH levels in reaction mixtures, ensuring accurate and reliable results. Additionally, it serves as a key component in the preparation of various biological buffers due to its ability to resist changes in pH when acids or bases are added. In organic synthesis, Tris(hydroxymethyl)methylaminopropanesulfonic acid plays a crucial role in controlling reaction conditions and improving reaction efficiency by providing a consistent and optimal pH environment. Its compatibility with a diverse array of chemicals and reagents makes it a valuable tool for chemists seeking to achieve precise and reproducible results in their synthetic endeavors.