
Catalog Number	AR002HLA
Chemical Name	3-Pyridinecarboxamide, 2-chloro-N-(4'-chloro[1,1'-biphenyl]-2-yl)-
CAS Number	188425-85-6
Molecular Formula	C18H12Cl2N2O
Molecular Weight	343.2067
MDL Number	MFCD06795150
SMILES	Clc1ccc(cc1)c1ccccc1NC(=O)c1cccnc1Cl

2-Chloro-N-(4'-chloro-[1,1'-biphenyl]-2-yl)nicotinamide is a versatile compound widely utilized in chemical synthesis processes. This compound serves as a valuable building block in the creation of complex organic molecules and pharmaceutical intermediates. Its unique structure and reactivity make it particularly suitable for cross-coupling reactions, such as Suzuki-Miyaura and Heck couplings, enabling the formation of carbon-carbon and carbon-heteroatom bonds. In addition, this compound can be employed as a key component in the synthesis of heterocyclic compounds and bioactive molecules, showcasing its significance in modern organic chemistry applications.

3-Pyridinecarboxamide, 2-chloro-N-(4'-chloro[1,1'-biphenyl]-2-yl)-

188425-85-6

Product Details