
Catalog Number	AR002606
Chemical Name	Benzoic acid, 2-bromo-6-(trifluoromethyl)-
CAS Number	177420-64-3
Molecular Formula	C8H4BrF3O2
Molecular Weight	269.0154
MDL Number	MFCD06253757
SMILES	OC(=O)c1c(Br)cccc1C(F)(F)F

2-Bromo-6-(trifluoromethyl)benzoic acid is a versatile compound widely used in chemical synthesis. Its primary application lies in its role as a valuable building block in the creation of various pharmaceuticals, agrochemicals, and advanced materials. Due to its unique structure and reactivity, this compound serves as a key intermediate in the synthesis of complex organic molecules. Specifically, 2-Bromo-6-(trifluoromethyl)benzoic acid is employed in the preparation of fluorinated aromatic compounds, which are essential in drug discovery and the development of novel materials with specific properties. Its presence as a functional group in organic molecules imparts desirable characteristics such as increased lipophilicity, metabolic stability, and enhanced binding affinity, thus making it a crucial component in the synthesis of bioactive compounds and specialty chemicals.