
Catalog Number	AR003H9N
Chemical Name	2-Benzenesulfonamidopyrimidine
CAS Number	16699-12-0
Molecular Formula	C10H9N3O2S
Molecular Weight	235.2624
MDL Number	MFCD00447813
SMILES	O=S(=O)(c1ccccc1)Nc1ncccn1

2-Benzenesulfonamidopyrimidine, also known as BSA Pyrimidine, is a versatile compound widely used in chemical synthesis for its unique reactivity and multiple applications. Known for its aromatic properties and sulfonamide group, 2-Benzenesulfonamidopyrimidine serves as a key building block in the synthesis of various pharmaceuticals, agrochemicals, and functional materials. Its ability to undergo nucleophilic substitution reactions makes it a valuable reagent in the preparation of biologically active compounds and complex organic structures. Additionally, 2-Benzenesulfonamidopyrimidine can be employed in the construction of heterocyclic frameworks and medicinal chemistry studies due to its versatile nature and diverse functional groups. Its significance in modern organic synthesis has contributed to the development of innovative molecules and enhanced the efficiency of drug discovery processes, showcasing its importance in the field of chemistry.

2-Benzenesulfonamidopyrimidine

16699-12-0

Product Details