
Catalog Number	AR0034QS
Chemical Name	2-(3-Methoxy-4-nitrophenyl)-4H-chromen-4-one
CAS Number	145370-39-4
Molecular Formula	C16H11NO5
Molecular Weight	297.2622
MDL Number	MFCD22479198
SMILES	COc1cc(ccc1[N+](=O)[O-])c1cc(=O)c2c(o1)cccc2

The compound 2-(3-Methoxy-4-nitrophenyl)-4H-chromen-4-one, also known as $name$, plays a crucial role in chemical synthesis as a versatile intermediate in organic reactions. Its unique structure featuring a chromenone moiety with methoxy and nitro substituents provides a diverse range of reactivity and functionalization options in synthetic chemistry. $name$ is commonly utilized in the synthesis of various organic compounds, particularly in the development of pharmaceuticals, agrochemicals, and materials with specific properties. Its presence as a key building block in organic transformations allows for the introduction of various functional groups, enabling the production of structurally complex molecules with desired biological or physical properties. Furthermore, the presence of the 4H-chromen-4-one scaffold in $name$ offers opportunities for further diversification through modification of the chromenone ring, leading to the creation of novel compounds for different applications. Whether employed in the construction of drug candidates, agrochemical agents, or advanced materials, the utility of 2-(3-Methoxy-4-nitrophenyl)-4H-chromen-4-one in chemical synthesis underscores its significance as a valuable tool for organic chemists in pursuing diverse synthetic goals.