
Catalog Number	AR000WEJ
Chemical Name	Benzene, 2-methoxy-1-methyl-4-nitro-
CAS Number	13120-77-9
Molecular Formula	C8H9NO3
Molecular Weight	167.162
MDL Number	MFCD00043912
SMILES	COc1cc(ccc1C)[N+](=O)[O-]
NSC Number	25213

2-Methyl-5-nitroanisole is a versatile organic compound commonly used in chemical synthesis, particularly in the field of organic chemistry. This chemical serves as a valuable building block for the production of various pharmaceuticals, agrochemicals, and specialty chemicals. With its unique structural properties, 2-Methyl-5-nitroanisole plays a crucial role in the creation of complex molecules through synthetic routes such as nitration, reduction, and rearrangement reactions. Its presence in the synthesis processes enables the formation of key intermediates that are essential for the development of new compounds with diverse functionalities and applications. In the hands of skilled chemists, 2-Methyl-5-nitroanisole serves as a fundamental tool in the construction of intricate chemical structures with precise control over regioselectivity and stereochemistry. Whether used as a key starting material or a strategic intermediate, this compound contributes significantly to the advancement of modern chemical synthesis techniques.

Benzene, 2-methoxy-1-methyl-4-nitro-

13120-77-9

Product Details