
Catalog Number	AR000M16
Chemical Name	Quinoline, 2-chloro-6-methoxy-3-methyl-
CAS Number	123990-76-1
Molecular Formula	C11H10ClNO
Molecular Weight	207.6562
MDL Number	MFCD02179792
SMILES	COc1ccc2c(c1)cc(c(n2)Cl)C

Quinoline, 2-chloro-6-methoxy-3-methyl-, is a versatile compound widely used in chemical synthesis. Its unique structure and reactivity make it a valuable building block in the production of various pharmaceuticals, agrochemicals, and specialty chemicals.In organic synthesis, Quinoline, 2-chloro-6-methoxy-3-methyl-, serves as a key intermediate in the preparation of complex molecules. Its substitution pattern allows for further functionalization through various chemical reactions, enabling the creation of diverse molecular structures.One common application of Quinoline, 2-chloro-6-methoxy-3-methyl-, is in the synthesis of biologically active compounds. By incorporating this compound into the molecular framework, researchers can modulate the pharmacological properties of the final products, potentially leading to the development of new drugs or therapeutic agents.Additionally, Quinoline, 2-chloro-6-methoxy-3-methyl-, can be utilized in the synthesis of organic ligands for catalysis or in the creation of specialized materials with unique properties. Its presence can impart specific characteristics to the final products, making it a valuable tool in the hands of synthetic chemists.Overall, Quinoline, 2-chloro-6-methoxy-3-methyl-, plays a crucial role in advancing chemical synthesis by enabling the construction of complex molecules with tailored functionalities and applications. Its versatility and reactivity make it a valuable asset in the realm of organic chemistry and pharmaceutical research.

Quinoline, 2-chloro-6-methoxy-3-methyl-

123990-76-1

Product Details