
Catalog Number	AR0081D2
Chemical Name	1-tert-butyl 2-methyl (2S,4R)-4-aminopyrrolidine-1,2-dicarboxylate
CAS Number	121148-00-3
Molecular Formula	C11H20N2O4
Molecular Weight	244.2875
MDL Number	MFCD01861782
SMILES	COC(=O)[C@@H]1C[C@H](CN1C(=O)OC(C)(C)C)N

The (2S,4R)-1-tert-Butyl 2-methyl 4-aminopyrrolidine-1,2-dicarboxylate, also known as $name$, is a valuable compound in chemical synthesis due to its chirality and structural properties. This compound is often utilized as a chiral building block in the synthesis of various complex organic molecules. Its unique stereochemistry, with the specific arrangement of the tert-butyl, methyl, amino, and dicarboxylate groups, allows for precise control over the stereochemical outcome of the reactions it participates in.$name$ can serve as a key intermediate in the construction of biologically active compounds, pharmaceuticals, and natural products. Its presence in a synthetic pathway can influence the overall stereochemistry of the final product, making it a crucial component for chemists aiming to access enantiomerically pure materials. By incorporating $name$ into a synthesis, chemists can access a wide range of structurally diverse molecules with high levels of stereochemical control.Furthermore, the tert-butyl and methyl groups in $name$ provide steric hindrance and structural rigidity, contributing to the overall stability and reactivity of the molecule during chemical transformations. This stability is essential in promoting selective reactions and minimizing unwanted byproducts, thereby streamlining the synthesis of complex molecules.In summary, the application of (2S,4R)-1-tert-Butyl 2-methyl 4-aminopyrrolidine-1,2-dicarboxylate in chemical synthesis offers chemists a versatile tool for accessing stereochemically pure and structurally complex compounds across various industries and research fields. Its unique combination of chirality and molecular properties makes it a valuable building block for the design and creation of diverse chemical structures with tailored stereochemical outcomes.