
Catalog Number	AR007FH0
Chemical Name	3-Bromo-5-(trifluoromethoxy)phenylboronic acid
CAS Number	1072951-48-4
Molecular Formula	C7H5BBrF3O3
Molecular Weight	284.823
MDL Number	MFCD11504853
SMILES	Brc1cc(cc(c1)B(O)O)OC(F)(F)F

The (3-Bromo-5-(trifluoromethoxy)phenyl)boronic acid is a highly versatile compound widely used in chemical synthesis due to its unique properties and reactivity. It serves as a key building block in the synthesis of various organic molecules, particularly in the field of medicinal chemistry and material science.This boronic acid derivative is commonly used as a substrate in various palladium-catalyzed cross-coupling reactions, such as Suzuki-Miyaura coupling, to form carbon-carbon bonds. This allows for the efficient and selective introduction of the (3-Bromo-5-(trifluoromethoxy)phenyl)boronic acid moiety into complex organic molecules.Additionally, its trifluoromethoxy group provides enhanced lipophilicity and electron-withdrawing properties, making it a valuable component in the design of bioactive molecules with improved pharmacological profiles. The presence of the bromine atom further enables the fine-tuning of the compound’s reactivity and selectivity in synthetic pathways.Overall, the (3-Bromo-5-(trifluoromethoxy)phenyl)boronic acid plays a crucial role in modern organic synthesis as a versatile building block for the construction of diverse chemical structures with applications ranging from drug discovery to materials science.