
Catalog Number	AR00QH82
Chemical Name	N-[4-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propane-2-sulfonamide
CAS Number	914606-98-7
Molecular Formula	C15H24BNO4S
Molecular Weight	325.23135999999994
MDL Number	MFCD22494279
SMILES	CC(S(=O)(=O)Nc1ccc(cc1)B1OC(C(O1)(C)C)(C)C)C

N-(4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)propane-2-sulfonamide is a versatile compound commonly employed in chemical synthesis as a key building block for constructing biologically active molecules and pharmaceuticals. Its unique structure with boron and sulfur moieties enables it to participate in diverse synthetic pathways, including Suzuki-Miyaura cross-coupling reactions, providing a valuable tool for the formation of complex organic compounds. This compound's use in medicinal chemistry and material science highlights its significance in designing novel functional molecules with desired properties for various applications.