
Catalog Number	AR01DP4X
Chemical Name	tert-Butyl 4-(6-nitro-2-oxo-2,3-dihydro-1H-benzo[d]imidazol-1-yl)piperidine-1-carboxylate
CAS Number	889942-01-2
Molecular Formula	C17H22N4O5
Molecular Weight	362.3804
MDL Number	MFCD07776419
SMILES	O=C(N1CCC(CC1)n1c(=O)[nH]c2c1cc(cc2)[N+](=O)[O-])OC(C)(C)C

The tert-Butyl 4-(6-nitro-2-oxo-2,3-dihydro-1H-benzo[d]imidazol-1-yl)piperidine-1-carboxylate is a versatile compound that finds application in chemical synthesis as a key intermediate in the preparation of various pharmaceuticals and organic molecules. This compound plays a crucial role in organic synthesis as a building block due to its unique structure and reactivity. It can undergo various chemical transformations such as acylation, alkylation, and reduction to introduce different functional groups, allowing chemists to create complex molecules efficiently.Its presence in the synthesis of pharmaceutical compounds highlights its importance in the development of new drugs and therapeutic agents. Additionally, its stability and compatibility with a wide range of reaction conditions make it a valuable tool for organic chemists aiming to access challenging molecular structures.Overall, tert-Butyl 4-(6-nitro-2-oxo-2,3-dihydro-1H-benzo[d]imidazol-1-yl)piperidine-1-carboxylate is a key player in chemical synthesis, enabling the production of diverse compounds with important applications in the pharmaceutical and chemical industries.