
Catalog Number	AR003BEQ
Chemical Name	2-(2,5-Dimethyl-1H-pyrrol-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine
CAS Number	885226-07-3
Molecular Formula	C17H23BN2O2
Molecular Weight	298.1877
MDL Number	MFCD13191378
SMILES	Cc1ccc(n1c1ccc(cn1)B1OC(C(O1)(C)C)(C)C)C

2-(2,5-Dimethyl-1H-pyrrol-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine is a versatile compound widely used in chemical synthesis. It serves as a valuable building block in the construction of organic molecules, particularly in the field of medicinal chemistry. This compound is often employed as a key intermediate in the synthesis of various biologically active molecules, such as pharmaceuticals and agrochemicals. Its unique structure makes it an ideal candidate for the modification and functionalization of complex organic scaffolds, allowing for the creation of novel compounds with desirable properties. Additionally, this compound exhibits excellent reactivity and compatibility with a wide range of synthetic methodologies, making it a valuable tool for organic chemists seeking to access diverse chemical space in their research and development endeavors.

2-(2,5-Dimethyl-1H-pyrrol-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pyridine

885226-07-3

Product Details