
Catalog Number	AR01DE7C
Chemical Name	(3-((4-Methoxybenzyl)carbamoyl)phenyl)boronic acid
CAS Number	874288-15-0
Molecular Formula	C15H16BNO4
Molecular Weight	285.1028
MDL Number	MFCD28167469
SMILES	COc1ccc(cc1)CNC(=O)c1cccc(c1)B(O)O

Boronic acid, B-[3-[[[(4-methoxyphenyl)methyl]amino]carbonyl]phenyl]- is a versatile compound widely utilized in chemical synthesis for its unique properties. This specific boronic acid derivative plays a crucial role as a key building block in organic reactions, particularly in Suzuki-Miyaura cross-coupling reactions. Its ability to form stable covalent bonds with electron-rich substrates makes it an essential reagent in the construction of complex organic molecules and pharmaceutical intermediates. With its strategic placement of functional groups, this boronic acid compound serves as a valuable tool for the selective modification of molecules, enabling precise control over the synthesis of target compounds in both academic and industrial research settings.