
Catalog Number	AR008G0L
Chemical Name	(4-(N-ETHYLSULFAMOYL)PHENYL)BORONIC ACID
CAS Number	871329-65-6
Molecular Formula	C8H12BNO4S
Molecular Weight	229.0612
MDL Number	MFCD07363751
SMILES	CCNS(=O)(=O)c1ccc(cc1)B(O)O

(4-(N-Ethylsulfamoyl)phenyl)boronic acid is a versatile compound widely used in chemical synthesis as a valuable building block and reagent. It serves as a key component in the formation of carbon-carbon and carbon-heteroatom bonds, allowing for the efficient and targeted synthesis of complex organic molecules. This boronic acid derivative is particularly useful in Suzuki-Miyaura cross-coupling reactions, enabling the construction of biaryl structures through the coupling of aryl halides or pseudohalides with arylboronic acids. Its unique structure incorporating an N-ethylsulfamoyl group further enhances its reactivity and selectivity in various synthetic transformations. Additionally, (4-(N-Ethylsulfamoyl)phenyl)boronic acid can be utilized in the preparation of pharmaceutical intermediates, agrochemicals, and materials science applications due to its ability to introduce functional groups with precision and efficiency. Its broad utility in organic synthesis makes it an indispensable tool for chemists seeking to access diverse molecular architectures with high synthetic versatility and control.