
Catalog Number	AR00IESB
Chemical Name	1H-Pyrazole,1-[(3-fluorophenyl)methyl]-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-
CAS Number	864771-96-0
Molecular Formula	C16H20BFN2O2
Molecular Weight	302.15160319999995
MDL Number	MFCD18383287
SMILES	Fc1cccc(c1)Cn1ncc(c1)B1OC(C(O1)(C)C)(C)C

1-(3-fluorobenzyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole is a valuable compound in chemical synthesis due to its versatility and unique reactivity. This compound can be utilized as a key building block in the synthesis of various organic molecules through Suzuki-Miyaura cross-coupling reactions. By functionalizing the boron atom in the dioxaborolane moiety, 1-(3-fluorobenzyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-1H-pyrazole can participate in efficient and selective C-C bond formation processes. This enables the incorporation of the fluorobenzyl and pyrazole groups into more complex structures, offering opportunities for the development of novel materials, pharmaceuticals, and agrochemicals.