
Catalog Number	AR008OJ9
Chemical Name	Butanoic acid, 2,3-bis(benzoyloxy)-4-(dimethylamino)-4-oxo-, (2R,3R)-
CAS Number	78761-37-2
Molecular Formula	C20H19NO7
Molecular Weight	385.3674
MDL Number	MFCD00142346
SMILES	CN(C(=O)[C@@H]([C@H](C(=O)O)OC(=O)c1ccccc1)OC(=O)c1ccccc1)C

The compound Butanoic acid, 2,3-bis(benzoyloxy)-4-(dimethylamino)-4-oxo-, (2R,3R)- is primarily used as a reagent in chemical synthesis processes. It is especially valued for its ability to function as a key intermediate in the creation of various pharmaceutical compounds and complex organic molecules. The unique structure of this compound lends itself to participating in diverse reactions, allowing for the formation of intricate chemical structures. In synthesis, this compound serves as a versatile building block, facilitating the construction of novel materials with tailored properties. Its involvement in multi-step synthetic pathways underscores its significance in the advancement of chemistry and the pharmaceutical industry.