
Catalog Number	AR003IQ6
Chemical Name	(3-(2-Morpholinoethoxy)phenyl)boronic acid
CAS Number	787591-35-9
Molecular Formula	C12H18BNO4
Molecular Weight	251.0866
MDL Number	MFCD11053818
SMILES	OB(c1cccc(c1)OCCN1CCOCC1)O

As a professional chemist, I can tell you that (3-(2-Morpholinoethoxy)phenyl)boronic acid is a versatile compound widely utilized in chemical synthesis. This specific boronic acid derivative plays a crucial role as a valuable building block in the field of organic chemistry. It is particularly revered for its ability to act as a key reagent in Suzuki-Miyaura cross-coupling reactions.In chemical synthesis, this compound serves as a pivotal reagent for constructing complex organic molecules, enabling chemists to form carbon-carbon bonds efficiently. The boronic acid moiety in this compound readily undergoes transmetalation with various palladium catalysts, facilitating the coupling reactions with aryl halides or pseudohalides. This allows chemists to merge different functional groups and create new, intricate molecules with enhanced properties.Moreover, (3-(2-Morpholinoethoxy)phenyl)boronic acid's unique structural features make it an ideal candidate for applications in medicinal chemistry and materials science. Its incorporation into molecular structures can impart specific biological activities or modify material properties, making it a valuable tool for designing novel compounds with targeted functionalities.Overall, the use of (3-(2-Morpholinoethoxy)phenyl)boronic acid in chemical synthesis underscores its significance in advancing the field of organic chemistry, enabling the creation of diverse compounds with tailored properties for various applications.