
Catalog Number	AR00GDG4
Chemical Name	Dibenz[b,f]oxepin-2-acetic acid, 10,11-dihydro-a,8-dimethyl-11-oxo-
CAS Number	78499-27-1
Molecular Formula	C18H16O4
Molecular Weight	296.3172
MDL Number	MFCD00866718
SMILES	OC(=O)C(c1ccc2c(c1)C(=O)Cc1c(O2)ccc(c1)C)C

In chemical synthesis, Bermoprofen plays a crucial role as a versatile building block and reagent. Known for its ability to undergo various functional group transformations, Bermoprofen is widely utilized in the creation of complex organic compounds. Its unique structural features make it particularly valuable for the synthesis of pharmaceutical intermediates, agrochemicals, and specialty chemicals. With its reactivity and selectivity, Bermoprofen enables chemists to efficiently construct intricate molecular structures with high precision. Additionally, its compatibility with a wide range of reaction conditions makes it a preferred choice in the synthesis of diverse chemical entities.