
Catalog Number	AR01CCVA
Chemical Name	2(3H)-Furanone, dihydro-3,4-bis[(3-hydroxyphenyl)methyl]-,(3R,4R)-rel-
CAS Number	78473-71-9
Molecular Formula	C18H18O4
Molecular Weight	298.3331
MDL Number	MFCD01861506
SMILES	Oc1cccc(c1)C[C@H]1C(=O)OC[C@@H]1Cc1cccc(c1)O

Enterolactone is a naturally occurring plant lignan derived from dietary sources such as flaxseeds, sesame seeds, and whole grains. It has gained significant attention in the field of chemical synthesis due to its versatile applications. In chemical synthesis, Enterolactone serves as a valuable precursor for producing various bioactive compounds and pharmaceutical intermediates. Its unique structure and reactivity make it a promising building block for the synthesis of complex molecules with potential therapeutic properties.One key application of Enterolactone in chemical synthesis is its role as a starting material for the synthesis of lignan analogs and derivatives. By introducing specific functional groups or modifying the chemical structure of Enterolactone, chemists can create novel compounds with enhanced biological activities. These derivatives have shown potential in various areas such as anti-cancer, anti-inflammatory, and antioxidant research.Additionally, Enterolactone can be utilized as a chiral building block in asymmetric synthesis. Its chirality provides an opportunity to access enantiomerically pure compounds, which are crucial in pharmaceutical development. Through strategic transformations of Enterolactone, chemists can access enantiomerically enriched molecules for drug discovery and development.Overall, Enterolactone's applications in chemical synthesis extend beyond its natural occurrence in plants. Its versatility and reactivity make it a valuable component in the toolbox of synthetic chemists for the creation of diverse compounds with potential therapeutic benefits.