
Catalog Number	AR00564N
Chemical Name	Quinoline,2-chloro-6-(trifluoromethyl)-
CAS Number	78060-56-7
Molecular Formula	C10H5ClF3N
Molecular Weight	231.6016
MDL Number	MFCD09029680
SMILES	Clc1ccc2c(n1)ccc(c2)C(F)(F)F

Quinoline, 2-chloro-6-(trifluoromethyl)- is a versatile compound widely used in chemical synthesis due to its unique properties and reactivity. This compound plays a vital role in the development of pharmaceuticals, agrochemicals, and materials science.In chemical synthesis, Quinoline, 2-chloro-6-(trifluoromethyl)- serves as a key building block in the production of various compounds. Its trifluoromethyl group imparts valuable properties such as increased lipophilicity and metabolic stability, making it an important component in drug discovery and development. This compound is often utilized in the modification of organic molecules to enhance their bioactivity and pharmacokinetic profiles.Additionally, Quinoline, 2-chloro-6-(trifluoromethyl)- is employed in the synthesis of fluorinated compounds, which are highly desirable in medicinal chemistry due to their ability to improve drug-target interactions and enhance biological activity. Its involvement in cross-coupling reactions and the formation of C–CF3 bonds further highlights its significance in the field of organic synthesis.Furthermore, this compound finds applications in the creation of advanced materials with tailored properties, including polymers, liquid crystals, and functionalized surfaces. Its versatile nature and compatibility with various reaction conditions make it a valuable tool for designing novel molecular structures with desirable characteristics.Overall, Quinoline, 2-chloro-6-(trifluoromethyl)- is a crucial intermediate in chemical synthesis, enabling the construction of diverse compounds with enhanced properties for applications across various industries.