
Catalog Number	AR00GHF2
Chemical Name	5-nitro-2,3-dihydroxynaphthalene
CAS Number	77542-54-2
Molecular Formula	C10H7NO4
Molecular Weight	205.1669
MDL Number	MFCD21340267
SMILES	[O-][N+](=O)c1cccc2c1cc(O)c(c2)O

5-Nitronaphthalene-2,3-diol is a versatile compound with valuable applications in chemical synthesis. This compound is commonly used as a building block for the synthesis of various organic molecules due to its unique structural properties. In the field of organic chemistry, 5-Nitronaphthalene-2,3-diol serves as a key intermediate in the synthesis of diverse heterocyclic compounds and pharmaceutical agents. Its ability to undergo various chemical transformations makes it an essential reagent for the preparation of complex molecules with potential industrial and medicinal significance. Furthermore, the presence of both nitro and hydroxyl functional groups in 5-Nitronaphthalene-2,3-diol allows for the selective modification of its chemical structure, enabling the synthesis of tailored compounds with specific properties. This compound plays a crucial role in the development of new materials, pharmaceuticals, and agrochemicals, highlighting its importance in modern chemical synthesis strategies.