
Catalog Number	AR01CCDJ
Chemical Name	4-Isoxazolepropanoic acid, a-amino-2,3-dihydro-5-methyl-3-oxo-
CAS Number	77521-29-0
Molecular Formula	C7H10N2O4
Molecular Weight	186.1653
MDL Number	MFCD00213388
SMILES	OC(=O)C(Cc1c(C)o[nH]c1=O)N

The α-amino-3-hydroxy-5-methylisoxazole-4-propionic acid, often abbreviated as AMPA, is a vital amino acid derivative widely utilized in chemical synthesis. AMPA finds significant application as a building block in the creation of diverse compounds and pharmaceuticals due to its unique structure and reactivity. In the field of organic chemistry, AMPA serves as a versatile intermediate in the formation of complex molecules, including drugs, agrochemicals, and materials. Its distinctive properties make it a valuable tool for chemists aiming to design and produce novel compounds with specific biological activities or structural features. Whether employed in the development of new pharmaceutical agents or the synthesis of advanced materials, AMPA plays a crucial role in facilitating innovative chemical reactions and enhancing the scope of synthetic possibilities.