
Catalog Number	AR01DE2O
Chemical Name	Methyl (E)-2-((2S,3R,12bR)-3-ethyl-1,2,3,4,6,7,12,12b-octahydroindolo[2,3-a]quinolizin-2-yl)-3-methoxyacrylate
CAS Number	7729-23-9
Molecular Formula	C22H28N2O3
Molecular Weight	368.46932
MDL Number	MFCD01750089
SMILES	CO/C=C(\[C@H]1C[C@H]2N(C[C@@H]1CC)CCc1c2[nH]c2c1cccc2)/C(=O)OC

Hirsutine, a natural alkaloid derived from Uncaria genus plants, has found diverse applications in chemical synthesis. In organic chemistry, Hirsutine serves as a valuable building block for the synthesis of various complex molecules due to its unique structural features and reactivity. By utilizing Hirsutine as a starting material or intermediate, chemists can access a wide array of functionalized compounds through strategic transformations. Its aromatic nature and nitrogen-containing functionalities make it a versatile precursor in the preparation of heterocyclic compounds, pharmaceutical agents, and other bioactive molecules. Hirsutine's presence in chemical reactions can impart specific stereochemical and biological properties to the final products, making it a valuable tool in the hands of synthetic chemists seeking innovative pathways towards novel compounds.