
Catalog Number	AR00GAL7
Chemical Name	4-chloro-7-methoxyquinoline-6-carboxylic acid
CAS Number	771464-30-3
Molecular Formula	C11H8ClNO3
Molecular Weight	237.6391
MDL Number	MFCD10697789
SMILES	COc1cc2nccc(c2cc1C(=O)O)Cl

4-Chloro-7-methoxy-6-quinolinecarboxylic acid is a versatile chemical compound widely utilized in chemical synthesis. This compound serves as a crucial building block in the creation of various pharmaceuticals, agrochemicals, and materials due to its unique structural properties and reactivity. Its presence in the synthesis process helps in the formation of intricate molecular structures and functional groups, enabling the development of novel compounds with specific biological or chemical properties. Additionally, 4-Chloro-7-methoxy-6-quinolinecarboxylic acid plays a significant role as a key intermediate in the production of diverse chemical substances, further highlighting its importance in the field of organic chemistry. By incorporating this compound into synthetic routes, chemists can efficiently access a wide range of target molecules with tailored characteristics and functionalities.