
Catalog Number	AR00JJ1U
Chemical Name	2-(4-Hydroxy-3-oxobutyl)-1h-isoindole-1,3(2H)-dione
CAS Number	76879-43-1
Molecular Formula	C12H11NO4
Molecular Weight	233.22003999999998
MDL Number	MFCD21876300
SMILES	OCC(=O)CCN1C(=O)c2c(C1=O)cccc2

The compound 2-(4-Hydroxy-3-oxobutyl)isoindoline-1,3-dione, also known as $name$, plays a crucial role in chemical synthesis as a versatile intermediate. It serves as a key building block for the construction of various complex molecules in organic synthesis.This compound is commonly utilized in the synthesis of pharmaceuticals, agrochemicals, and fine chemicals due to its unique structural features and reactivity. With its functional groups, $name$ can undergo various chemical transformations, such as acylation, alkylation, and condensation reactions, enabling the efficient creation of diverse organic compounds.Moreover, the presence of the isoindoline moiety in $name$ imparts specific properties to the molecules synthesized from it, making it a valuable precursor in the development of bioactive compounds and materials with tailored characteristics.In summary, the application of 2-(4-Hydroxy-3-oxobutyl)isoindoline-1,3-dione in chemical synthesis serves as a fundamental step in the design and preparation of novel molecules with potential applications in the fields of medicine, agriculture, and materials science.