
Catalog Number	AR00G5P4
Chemical Name	3'-N,N-Di(desmethyl)-3'-N-formyl Azithromycin
CAS Number	765927-71-7
Molecular Formula	C37H68N2O13
Molecular Weight	748.9414
SMILES	O=CNC1CC(C)OC(C1O)OC1C(C)C(OC2OC(C)C(C(C2)(C)OC)O)C(C)C(=O)OC(CC)C(C(C(N(CC(CC1(C)O)C)C)C)O)(C)O

3’-N,N-Di(desmethyl)-3’-N-formyl Azithromycin is a valuable compound that finds application in chemical synthesis as a versatile building block. Its unique structure allows for the introduction of functional groups at specific positions, making it a key intermediate in the preparation of pharmaceuticals and complex organic molecules. By incorporating 3’-N,N-Di(desmethyl)-3’-N-formyl Azithromycin into synthetic pathways, chemists can access a diverse array of derivatives with tailored properties and enhanced biological activity. This compound serves as a strategic tool for creating novel drug candidates, agrochemicals, and materials with improved performance and efficacy.