
Catalog Number	AR00IDFZ
Chemical Name	2,3,3-trimethyl-1-(3-sulfopropyl)indol-1-ium-5-sulfonate
CAS Number	76578-90-0
Molecular Formula	C14H19NO6S2
Molecular Weight	361.43375999999995
MDL Number	MFCD12545732
SMILES	CC1=[N+](CCCS(=O)(=O)O)c2c(C1(C)C)cc(cc2)S(=O)(=O)[O-]

When utilized in chemical synthesis, 2,3,3-Trimethyl-1-(3-sulfopropyl)-3H-indol-1-ium-5-sulfonate serves as a crucial reagent for the functionalization and modification of organic compounds. This compound demonstrates exceptional versatility in catalyzing various complex reactions due to its unique structural characteristics. Its sulfonate groups enable it to act as a potent leaving group, facilitating substitution reactions and promoting the formation of new chemical bonds.Additionally, the sulfopropyl moiety enhances the solubility of the compound in aqueous solvents, making it particularly advantageous for reactions carried out in polar environments. This feature makes 2,3,3-Trimethyl-1-(3-sulfopropyl)-3H-indol-1-ium-5-sulfonate a valuable tool in the synthesis of water-soluble organic molecules and pharmaceutical intermediates. Its utility extends to diverse fields such as medicinal chemistry, material science, and bioconjugation reactions, where precise control over reactivity and solubility is paramount for successful outcomes.