
Catalog Number	AR005R2S
Chemical Name	2-Methyl-4-nitro-1H-benzo[d]imidazole
CAS Number	76320-88-2
Molecular Formula	C8H7N3O2
Molecular Weight	177.1601
MDL Number	MFCD02181148
SMILES	[O-][N+](=O)c1cccc2c1nc([nH]2)C

2-Methyl-4-nitro-1H-benzo[d]imidazole is a versatile chemical compound widely used in chemical synthesis due to its unique properties and reactivity. This compound serves as a valuable building block in the synthesis of various pharmaceuticals, agrochemicals, and functional materials. Its nitro and imidazole functional groups make it a key intermediate in the production of complex organic molecules through different chemical reactions such as reduction, substitution, and condensation. In organic chemistry, 2-Methyl-4-nitro-1H-benzo[d]imidazole is particularly employed in the creation of heterocyclic compounds, which are essential in drug discovery and material science. Its presence in the chemical synthesis process offers chemists a powerful tool to develop new compounds with diverse biological activities and physical properties.