
Catalog Number	AR008OQE
Chemical Name	2,4-THIAZOLIDINEDIONE, 5-[[4-[2-[[6-(4-METHOXYPHENOXY)-4-PYRIMIDINYL]METHYLAMINO]ETHOXY]PHENYL]METHYL]-, SULFATE (1:1)
CAS Number	763108-62-9
Molecular Formula	C24H26N4O9S2
Molecular Weight	578.6146
MDL Number	MFCD09832515
SMILES	OS(=O)(=O)O.COc1ccc(cc1)Oc1ncnc(c1)CNCCOc1ccc(cc1)CC1SC(=O)NC1=O

The compound 2,4-thiazolidinedione, 5-[[4-[2-[[6-(4-methoxyphenoxy)-4-pyrimidinyl]methylamino]ethoxy]phenyl]methyl]-, sulfate (1:1) is a versatile reagent commonly utilized in chemical synthesis processes. It serves as a key building block in the creation of various pharmaceuticals and agrochemicals due to its unique chemical properties and structural features. In chemical synthesis, this compound acts as a crucial intermediate in the development of innovative molecules with potential applications in the fields of medicine, agriculture, and materials science. Its strategic incorporation in synthetic pathways allows for the efficient generation of complex organic compounds with tailored functionalities, paving the way for the advancement of diverse industries and scientific research endeavors.