
Catalog Number	AR00GA7A
Chemical Name	1-[3-(trifluoromethyl)phenyl]-1H-pyrazole-4-carbaldehyde
CAS Number	75815-73-5
Molecular Formula	C11H7F3N2O
Molecular Weight	240.1813
MDL Number	MFCD09951288
SMILES	O=Cc1cnn(c1)c1cccc(c1)C(F)(F)F

In chemical synthesis, 1-(3-(Trifluoromethyl)phenyl)-1H-pyrazole-4-carbaldehyde plays a crucial role as a versatile building block. This compound is commonly utilized as a key intermediate in the preparation of various pharmaceuticals, agrochemicals, and functional materials. Its unique structure containing both a pyrazole and an aldehyde group enables it to participate in a wide range of organic transformations, serving as a valuable precursor for the introduction of diverse functional groups. Additionally, the trifluoromethyl substituent confers special properties to the molecule, offering opportunities for the design of new molecules with enhanced biological activities or improved physicochemical properties.