
Catalog Number	AR005J3V
Chemical Name	3-Bromo-3'-chlorobenzophenone
CAS Number	75762-59-3
Molecular Formula	C13H8BrClO
Molecular Weight	295.559
MDL Number	MFCD06201573
SMILES	Clc1cccc(c1)C(=O)c1cccc(c1)Br

3-BROMO-3'-CHLOROBENZOPHENONE is a versatile chemical compound that finds wide application in various chemical synthesis processes. In organic chemistry, this compound serves as a valuable building block for the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. Its unique molecular structure allows for the introduction of both bromine and chlorine atoms into the target molecules, enabling the creation of complex organic compounds. Specifically, 3-BROMO-3'-CHLOROBENZOPHENONE is frequently utilized as a key intermediate in the production of heterocyclic compounds, such as benzimidazoles and benzothiazoles, which have significant biological activities. Additionally, this compound can be employed in the preparation of advanced materials and functionalized organic molecules for various industrial applications. In essence, 3-BROMO-3'-CHLOROBENZOPHENONE plays a crucial role in the realm of chemical synthesis by facilitating the construction of diverse molecular structures with tailored properties and functionalities.